About aluminum;3-oxidonaphthalene-2-carboxylate;hydroxide;hydrate
aluminum;3-oxidonaphthalene-2-carboxylate;hydroxide;hydrate (PubChem CID 101322218) has the molecular formula C11H9AlO5
and a molecular weight of 248.17 g/mol. Its IUPAC name is aluminum;3-oxidonaphthalene-2-carboxylate;hydroxide;hydrate.
Molecular Properties
| Compound Name | aluminum;3-oxidonaphthalene-2-carboxylate;hydroxide;hydrate |
| PubChem CID | 101322218 |
| Molecular Formula | C11H9AlO5 |
| Molecular Weight | 248.17 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | aluminum;3-oxidonaphthalene-2-carboxylate;hydroxide;hydrate |
| SMILES | O.O=C([O-])c1cc2ccccc2cc1[O-].[Al+3].[OH-] |
| InChI | InChI=1S/C11H8O3.Al.2H2O/c12-10-6-8-4-2-1-3-7(8)5-9(10)11(13)14;;;/h1-6,12H,(H,13,14);;2*1H2/q;+3;;/p-3 |
| InChIKey | DUPWMVUQVBOOIF-UHFFFAOYSA-K |
| XLogP | -1.11 |
| TPSA | 124.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.17 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze aluminum;3-oxidonaphthalene-2-carboxylate;hydroxide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aluminum;3-oxidonaphthalene-2-carboxylate;hydroxide;hydrate?
The IUPAC name of aluminum;3-oxidonaphthalene-2-carboxylate;hydroxide;hydrate (CID 101322218) is aluminum;3-oxidonaphthalene-2-carboxylate;hydroxide;hydrate.
What is the SMILES notation for aluminum;3-oxidonaphthalene-2-carboxylate;hydroxide;hydrate?
The canonical SMILES for aluminum;3-oxidonaphthalene-2-carboxylate;hydroxide;hydrate is O.O=C([O-])c1cc2ccccc2cc1[O-].[Al+3].[OH-].
What is the InChIKey of aluminum;3-oxidonaphthalene-2-carboxylate;hydroxide;hydrate?
The InChIKey is DUPWMVUQVBOOIF-UHFFFAOYSA-K. The full InChI is InChI=1S/C11H8O3.Al.2H2O/c12-10-6-8-4-2-1-3-7(8)5-9(10)11(13)14;;;/h1-6,12H,(H,13,14);;2*1H2/q;+3;;/p-3.
What are the key properties of aluminum;3-oxidonaphthalene-2-carboxylate;hydroxide;hydrate?
aluminum;3-oxidonaphthalene-2-carboxylate;hydroxide;hydrate has a molecular weight of 248.17 g/mol, XLogP of -1.11, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for aluminum;3-oxidonaphthalene-2-carboxylate;hydroxide;hydrate is sourced from PubChem (CID 101322218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).