About 1-cyclohexyl-N-methoxy-1-(1-phenylpyrrol-3-yl)methanimine;sulfur dioxide
1-cyclohexyl-N-methoxy-1-(1-phenylpyrrol-3-yl)methanimine;sulfur dioxide (PubChem CID 165037384) has the molecular formula C18H22N2O3S
and a molecular weight of 346.45 g/mol. Its IUPAC name is 1-cyclohexyl-N-methoxy-1-(1-phenylpyrrol-3-yl)methanimine;sulfur dioxide.
Molecular Properties
| Compound Name | 1-cyclohexyl-N-methoxy-1-(1-phenylpyrrol-3-yl)methanimine;sulfur dioxide |
| PubChem CID | 165037384 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 1-cyclohexyl-N-methoxy-1-(1-phenylpyrrol-3-yl)methanimine;sulfur dioxide |
| SMILES | CON=C(c1ccn(-c2ccccc2)c1)C1CCCCC1.O=S=O |
| InChI | InChI=1S/C18H22N2O.O2S/c1-21-19-18(15-8-4-2-5-9-15)16-12-13-20(14-16)17-10-6-3-7-11-17;1-3-2/h3,6-7,10-15H,2,4-5,8-9H2,1H3; |
| InChIKey | NPACSTWRZQLNAV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexyl-N-methoxy-1-(1-phenylpyrrol-3-yl)methanimine;sulfur dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-N-methoxy-1-(1-phenylpyrrol-3-yl)methanimine;sulfur dioxide?
The IUPAC name of 1-cyclohexyl-N-methoxy-1-(1-phenylpyrrol-3-yl)methanimine;sulfur dioxide (CID 165037384) is 1-cyclohexyl-N-methoxy-1-(1-phenylpyrrol-3-yl)methanimine;sulfur dioxide.
What is the SMILES notation for 1-cyclohexyl-N-methoxy-1-(1-phenylpyrrol-3-yl)methanimine;sulfur dioxide?
The canonical SMILES for 1-cyclohexyl-N-methoxy-1-(1-phenylpyrrol-3-yl)methanimine;sulfur dioxide is CON=C(c1ccn(-c2ccccc2)c1)C1CCCCC1.O=S=O.
What is the InChIKey of 1-cyclohexyl-N-methoxy-1-(1-phenylpyrrol-3-yl)methanimine;sulfur dioxide?
The InChIKey is NPACSTWRZQLNAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O.O2S/c1-21-19-18(15-8-4-2-5-9-15)16-12-13-20(14-16)17-10-6-3-7-11-17;1-3-2/h3,6-7,10-15H,2,4-5,8-9H2,1H3;.
What are the key properties of 1-cyclohexyl-N-methoxy-1-(1-phenylpyrrol-3-yl)methanimine;sulfur dioxide?
1-cyclohexyl-N-methoxy-1-(1-phenylpyrrol-3-yl)methanimine;sulfur dioxide has a molecular weight of 346.45 g/mol, XLogP of 3.74, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-N-methoxy-1-(1-phenylpyrrol-3-yl)methanimine;sulfur dioxide is sourced from PubChem (CID 165037384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).