C22H33NOSSi — CID 24750122
(R)-2-methyl-N-[(1R)-3-methyl-1-[methyl(diphenyl)silyl]butyl]propane-2-sulfinamide (PubChem CID 24750122) has the molecular formula C22H33NOSSi and a molecular weight of 387.67 g/mol. Its IUPAC name is (R)-2-methyl-N-[(1R)-3-methyl-1-[methyl(diphenyl)silyl]butyl]propane-2-sulfinamide.
| Compound Name | (R)-2-methyl-N-[(1R)-3-methyl-1-[methyl(diphenyl)silyl]butyl]propane-2-sulfinamide |
|---|---|
| PubChem CID | 24750122 |
| Molecular Formula | C22H33NOSSi |
| Molecular Weight | 387.67 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | (R)-2-methyl-N-[(1R)-3-methyl-1-[methyl(diphenyl)silyl]butyl]propane-2-sulfinamide |
| SMILES | CC(C)C[C@H](N[S@](=O)C(C)(C)C)[Si](C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H33NOSSi/c1-18(2)17-21(23-25(24)22(3,4)5)26(6,19-13-9-7-10-14-19)20-15-11-8-12-16-20/h7-16,18,21,23H,17H2,1-6H3/t21-,25-/m1/s1 |
| InChIKey | RGILSLXNEYLZSH-PXDATVDWSA-N |
| XLogP | 3.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.67 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|