C18H28OSi — CID 102328927
(1E,3S,4S)-4-tert-butyl-1-[dimethyl(phenyl)silyl]hexa-1,5-dien-3-ol (PubChem CID 102328927) has the molecular formula C18H28OSi and a molecular weight of 288.51 g/mol. Its IUPAC name is (1E,3S,4S)-4-tert-butyl-1-[dimethyl(phenyl)silyl]hexa-1,5-dien-3-ol.
| Compound Name | (1E,3S,4S)-4-tert-butyl-1-[dimethyl(phenyl)silyl]hexa-1,5-dien-3-ol |
|---|---|
| PubChem CID | 102328927 |
| Molecular Formula | C18H28OSi |
| Molecular Weight | 288.51 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | (1E,3S,4S)-4-tert-butyl-1-[dimethyl(phenyl)silyl]hexa-1,5-dien-3-ol |
| SMILES | C=C[C@H]([C@H](O)/C=C/[Si](C)(C)c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C18H28OSi/c1-7-16(18(2,3)4)17(19)13-14-20(5,6)15-11-9-8-10-12-15/h7-14,16-17,19H,1H2,2-6H3/b14-13+/t16-,17-/m1/s1 |
| InChIKey | IZQXKDZJLCXXDW-UEWLMQCVSA-N |
| XLogP | 3.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|