C13H20OSi — CID 11775664
(E,3S)-1-[dimethyl(phenyl)silyl]pent-1-en-3-ol (PubChem CID 11775664) has the molecular formula C13H20OSi and a molecular weight of 220.39 g/mol. Its IUPAC name is (E,3S)-1-[dimethyl(phenyl)silyl]pent-1-en-3-ol.
| Compound Name | (E,3S)-1-[dimethyl(phenyl)silyl]pent-1-en-3-ol |
|---|---|
| PubChem CID | 11775664 |
| Molecular Formula | C13H20OSi |
| Molecular Weight | 220.39 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | (E,3S)-1-[dimethyl(phenyl)silyl]pent-1-en-3-ol |
| SMILES | CC[C@H](O)/C=C/[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C13H20OSi/c1-4-12(14)10-11-15(2,3)13-8-6-5-7-9-13/h5-12,14H,4H2,1-3H3/b11-10+/t12-/m0/s1 |
| InChIKey | WGAOINODIYWBOI-IIANPFDCSA-N |
| XLogP | 2.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|