C18H26Si — CID 11086845
dimethyl-[(1Z,5Z)-7-methyl-4-methylideneocta-1,5-dienyl]-phenylsilane (PubChem CID 11086845) has the molecular formula C18H26Si and a molecular weight of 270.49 g/mol. Its IUPAC name is dimethyl-[(1Z,5Z)-7-methyl-4-methylideneocta-1,5-dienyl]-phenylsilane.
| Compound Name | dimethyl-[(1Z,5Z)-7-methyl-4-methylideneocta-1,5-dienyl]-phenylsilane |
|---|---|
| PubChem CID | 11086845 |
| Molecular Formula | C18H26Si |
| Molecular Weight | 270.49 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | dimethyl-[(1Z,5Z)-7-methyl-4-methylideneocta-1,5-dienyl]-phenylsilane |
| SMILES | C=C(/C=C\C(C)C)C/C=C\[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C18H26Si/c1-16(2)13-14-17(3)10-9-15-19(4,5)18-11-7-6-8-12-18/h6-9,11-16H,3,10H2,1-2,4-5H3/b14-13-,15-9- |
| InChIKey | VPCNFKXUKPGPKY-SILPWQIQSA-N |
| XLogP | 4.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.49 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|