C15H22Si — CID 10609523
trimethyl-[(1Z)-3-methyl-2-phenylpenta-1,4-dienyl]silane (PubChem CID 10609523) has the molecular formula C15H22Si and a molecular weight of 230.43 g/mol. Its IUPAC name is trimethyl-[(1Z)-3-methyl-2-phenylpenta-1,4-dienyl]silane.
| Compound Name | trimethyl-[(1Z)-3-methyl-2-phenylpenta-1,4-dienyl]silane |
|---|---|
| PubChem CID | 10609523 |
| Molecular Formula | C15H22Si |
| Molecular Weight | 230.43 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | trimethyl-[(1Z)-3-methyl-2-phenylpenta-1,4-dienyl]silane |
| SMILES | C=CC(C)/C(=C/[Si](C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C15H22Si/c1-6-13(2)15(12-16(3,4)5)14-10-8-7-9-11-14/h6-13H,1H2,2-5H3/b15-12- |
| InChIKey | OYUCSHQVWPPHQZ-QINSGFPZSA-N |
| XLogP | 4.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.43 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|