C14H18Si — CID 71350225
trimethyl(2-phenylpenta-1,3,4-trienyl)silane (PubChem CID 71350225) has the molecular formula C14H18Si and a molecular weight of 214.38 g/mol. Its IUPAC name is trimethyl(2-phenylpenta-1,3,4-trienyl)silane.
| Compound Name | trimethyl(2-phenylpenta-1,3,4-trienyl)silane |
|---|---|
| PubChem CID | 71350225 |
| Molecular Formula | C14H18Si |
| Molecular Weight | 214.38 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | trimethyl(2-phenylpenta-1,3,4-trienyl)silane |
| SMILES | C=C=CC(=C[Si](C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C14H18Si/c1-5-9-14(12-15(2,3)4)13-10-7-6-8-11-13/h6-12H,1H2,2-4H3 |
| InChIKey | WMFQUNYBJUSSJF-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.38 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|