C26H28Si — CID 601377
trimethyl(2,5,5-triphenylpenta-1,4-dienyl)silane (PubChem CID 601377) has the molecular formula C26H28Si and a molecular weight of 368.60 g/mol. Its IUPAC name is trimethyl(2,5,5-triphenylpenta-1,4-dienyl)silane.
| Compound Name | trimethyl(2,5,5-triphenylpenta-1,4-dienyl)silane |
|---|---|
| PubChem CID | 601377 |
| Molecular Formula | C26H28Si |
| Molecular Weight | 368.60 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | trimethyl(2,5,5-triphenylpenta-1,4-dienyl)silane |
| SMILES | C[Si](C)(C)C=C(CC=C(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H28Si/c1-27(2,3)21-25(22-13-7-4-8-14-22)19-20-26(23-15-9-5-10-16-23)24-17-11-6-12-18-24/h4-18,20-21H,19H2,1-3H3 |
| InChIKey | UXPQGNWCLCHUCJ-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.60 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|