C19H21ISi — CID 10250621
[(1E)-1-iodo-4,4-diphenylbuta-1,3-dienyl]-trimethylsilane (PubChem CID 10250621) has the molecular formula C19H21ISi and a molecular weight of 404.37 g/mol. Its IUPAC name is [(1E)-1-iodo-4,4-diphenylbuta-1,3-dienyl]-trimethylsilane.
| Compound Name | [(1E)-1-iodo-4,4-diphenylbuta-1,3-dienyl]-trimethylsilane |
|---|---|
| PubChem CID | 10250621 |
| Molecular Formula | C19H21ISi |
| Molecular Weight | 404.37 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | [(1E)-1-iodo-4,4-diphenylbuta-1,3-dienyl]-trimethylsilane |
| SMILES | C[Si](C)(C)/C(I)=C\C=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H21ISi/c1-21(2,3)19(20)15-14-18(16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-15H,1-3H3/b19-15- |
| InChIKey | DYOQOSQKDIBWNQ-CYVLTUHYSA-N |
| XLogP | 6.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.37 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|