C28H24N2 — CID 22124141
4-[1-(4-aminophenyl)-4,4-diphenylbuta-1,3-dienyl]aniline (PubChem CID 22124141) has the molecular formula C28H24N2 and a molecular weight of 388.51 g/mol. Its IUPAC name is 4-[1-(4-aminophenyl)-4,4-diphenylbuta-1,3-dienyl]aniline.
| Compound Name | 4-[1-(4-aminophenyl)-4,4-diphenylbuta-1,3-dienyl]aniline |
|---|---|
| PubChem CID | 22124141 |
| Molecular Formula | C28H24N2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 4-[1-(4-aminophenyl)-4,4-diphenylbuta-1,3-dienyl]aniline |
| SMILES | Nc1ccc(C(=CC=C(c2ccccc2)c2ccccc2)c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C28H24N2/c29-25-15-11-23(12-16-25)28(24-13-17-26(30)18-14-24)20-19-27(21-7-3-1-4-8-21)22-9-5-2-6-10-22/h1-20H,29-30H2 |
| InChIKey | FJKBIOZDWQMQPU-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|