C15H14S — CID 87371964
3,3-diphenylprop-2-ene-1-thiol (PubChem CID 87371964) has the molecular formula C15H14S and a molecular weight of 226.34 g/mol. Its IUPAC name is 3,3-diphenylprop-2-ene-1-thiol.
| Compound Name | 3,3-diphenylprop-2-ene-1-thiol |
|---|---|
| PubChem CID | 87371964 |
| Molecular Formula | C15H14S |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 3,3-diphenylprop-2-ene-1-thiol |
| SMILES | SCC=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H14S/c16-12-11-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-11,16H,12H2 |
| InChIKey | ULKZQPZUJIWPLO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|