About [2-(2,2-diphenylethenyldiselanyl)-1-phenylethenyl]benzene
[2-(2,2-diphenylethenyldiselanyl)-1-phenylethenyl]benzene (PubChem CID 134932536) has the molecular formula C28H22Se2
and a molecular weight of 516.40 g/mol. Its IUPAC name is [2-(2,2-diphenylethenyldiselanyl)-1-phenylethenyl]benzene.
Molecular Properties
| Compound Name | [2-(2,2-diphenylethenyldiselanyl)-1-phenylethenyl]benzene |
| PubChem CID | 134932536 |
| Molecular Formula | C28H22Se2 |
| Molecular Weight | 516.40 g/mol |
| Exact Mass | 518.01 |
| IUPAC Name | [2-(2,2-diphenylethenyldiselanyl)-1-phenylethenyl]benzene |
| SMILES | C([Se][Se]C=C(c1ccccc1)c1ccccc1)=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H22Se2/c1-5-13-23(14-6-1)27(24-15-7-2-8-16-24)21-29-30-22-28(25-17-9-3-10-18-25)26-19-11-4-12-20-26/h1-22H |
| InChIKey | SHAJPMSYYAZVJG-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 516.40 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [2-(2,2-diphenylethenyldiselanyl)-1-phenylethenyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,2-diphenylethenyldiselanyl)-1-phenylethenyl]benzene?
The IUPAC name of [2-(2,2-diphenylethenyldiselanyl)-1-phenylethenyl]benzene (CID 134932536) is [2-(2,2-diphenylethenyldiselanyl)-1-phenylethenyl]benzene.
What is the SMILES notation for [2-(2,2-diphenylethenyldiselanyl)-1-phenylethenyl]benzene?
The canonical SMILES for [2-(2,2-diphenylethenyldiselanyl)-1-phenylethenyl]benzene is C([Se][Se]C=C(c1ccccc1)c1ccccc1)=C(c1ccccc1)c1ccccc1.
What is the InChIKey of [2-(2,2-diphenylethenyldiselanyl)-1-phenylethenyl]benzene?
The InChIKey is SHAJPMSYYAZVJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H22Se2/c1-5-13-23(14-6-1)27(24-15-7-2-8-16-24)21-29-30-22-28(25-17-9-3-10-18-25)26-19-11-4-12-20-26/h1-22H.
What are the key properties of [2-(2,2-diphenylethenyldiselanyl)-1-phenylethenyl]benzene?
[2-(2,2-diphenylethenyldiselanyl)-1-phenylethenyl]benzene has a molecular weight of 516.40 g/mol, XLogP of 6.49, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,2-diphenylethenyldiselanyl)-1-phenylethenyl]benzene is sourced from PubChem (CID 134932536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).