C20H15FSe — CID 150580942
1-(2,2-diphenylethenylselanyl)-4-fluorobenzene (PubChem CID 150580942) has the molecular formula C20H15FSe and a molecular weight of 353.30 g/mol. Its IUPAC name is 1-(2,2-diphenylethenylselanyl)-4-fluorobenzene.
| Compound Name | 1-(2,2-diphenylethenylselanyl)-4-fluorobenzene |
|---|---|
| PubChem CID | 150580942 |
| Molecular Formula | C20H15FSe |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | 1-(2,2-diphenylethenylselanyl)-4-fluorobenzene |
| SMILES | Fc1ccc([Se]C=C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H15FSe/c21-18-11-13-19(14-12-18)22-15-20(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-15H |
| InChIKey | INUWDDIMKXJZSV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|