C8H8O2Se — CID 11790922
2-phenylselanylethene-1,1-diol (PubChem CID 11790922) has the molecular formula C8H8O2Se and a molecular weight of 215.11 g/mol. Its IUPAC name is 2-phenylselanylethene-1,1-diol.
| Compound Name | 2-phenylselanylethene-1,1-diol |
|---|---|
| PubChem CID | 11790922 |
| Molecular Formula | C8H8O2Se |
| Molecular Weight | 215.11 g/mol |
| Exact Mass | 215.97 |
| IUPAC Name | 2-phenylselanylethene-1,1-diol |
| SMILES | OC(O)=C[Se]c1ccccc1 |
| InChI | InChI=1S/C8H8O2Se/c9-8(10)6-11-7-4-2-1-3-5-7/h1-6,9-10H |
| InChIKey | CMKIJRQWWIOBBS-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.11 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|