C25H32O3Si — CID 5375585
(E)-5-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-2-methylideneoct-6-enal (PubChem CID 5375585) has the molecular formula C25H32O3Si and a molecular weight of 408.61 g/mol. Its IUPAC name is (E)-5-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-2-methylideneoct-6-enal.
| Compound Name | (E)-5-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-2-methylideneoct-6-enal |
|---|---|
| PubChem CID | 5375585 |
| Molecular Formula | C25H32O3Si |
| Molecular Weight | 408.61 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | (E)-5-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-2-methylideneoct-6-enal |
| SMILES | C=C(C=O)C(O)CC(/C=C/C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H32O3Si/c1-6-13-21(18-24(27)20(2)19-26)28-29(25(3,4)5,22-14-9-7-10-15-22)23-16-11-8-12-17-23/h6-17,19,21,24,27H,2,18H2,1,3-5H3/b13-6+ |
| InChIKey | BGJOROFETNPHTG-AWNIVKPZSA-N |
| XLogP | 4.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.61 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|