C24H30OSi — CID 10713704
tert-butyl-[(E,3R,4R)-4-methylhept-5-en-1-yn-3-yl]oxy-diphenylsilane (PubChem CID 10713704) has the molecular formula C24H30OSi and a molecular weight of 362.59 g/mol. Its IUPAC name is tert-butyl-[(E,3R,4R)-4-methylhept-5-en-1-yn-3-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(E,3R,4R)-4-methylhept-5-en-1-yn-3-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 10713704 |
| Molecular Formula | C24H30OSi |
| Molecular Weight | 362.59 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | tert-butyl-[(E,3R,4R)-4-methylhept-5-en-1-yn-3-yl]oxy-diphenylsilane |
| SMILES | C#C[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](C)/C=C/C |
| InChI | InChI=1S/C24H30OSi/c1-7-15-20(3)23(8-2)25-26(24(4,5)6,21-16-11-9-12-17-21)22-18-13-10-14-19-22/h2,7,9-20,23H,1,3-6H3/b15-7+/t20-,23+/m1/s1 |
| InChIKey | SRZJISSXBNMOGB-DSVVGZGVSA-N |
| XLogP | 4.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.59 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|