C28H38O4Si — CID 101273818
propan-2-yl (E,4S,5R)-5-[tert-butyl(diphenyl)silyl]oxy-4-methyl-2-oxooct-6-enoate (PubChem CID 101273818) has the molecular formula C28H38O4Si and a molecular weight of 466.69 g/mol. Its IUPAC name is propan-2-yl (E,4S,5R)-5-[tert-butyl(diphenyl)silyl]oxy-4-methyl-2-oxooct-6-enoate.
| Compound Name | propan-2-yl (E,4S,5R)-5-[tert-butyl(diphenyl)silyl]oxy-4-methyl-2-oxooct-6-enoate |
|---|---|
| PubChem CID | 101273818 |
| Molecular Formula | C28H38O4Si |
| Molecular Weight | 466.69 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | propan-2-yl (E,4S,5R)-5-[tert-butyl(diphenyl)silyl]oxy-4-methyl-2-oxooct-6-enoate |
| SMILES | C/C=C/[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](C)CC(=O)C(=O)OC(C)C |
| InChI | InChI=1S/C28H38O4Si/c1-8-15-26(22(4)20-25(29)27(30)31-21(2)3)32-33(28(5,6)7,23-16-11-9-12-17-23)24-18-13-10-14-19-24/h8-19,21-22,26H,20H2,1-7H3/b15-8+/t22-,26-/m0/s1 |
| InChIKey | YPZKWWAEFXQMQH-YHKQTXNGSA-N |
| XLogP | 5.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.69 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|