C22H34OSi2 — CID 67804101
tert-butyl-(2-methoxy-1-trimethylsilylethyl)-diphenylsilane (PubChem CID 67804101) has the molecular formula C22H34OSi2 and a molecular weight of 370.69 g/mol. Its IUPAC name is tert-butyl-(2-methoxy-1-trimethylsilylethyl)-diphenylsilane.
| Compound Name | tert-butyl-(2-methoxy-1-trimethylsilylethyl)-diphenylsilane |
|---|---|
| PubChem CID | 67804101 |
| Molecular Formula | C22H34OSi2 |
| Molecular Weight | 370.69 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | tert-butyl-(2-methoxy-1-trimethylsilylethyl)-diphenylsilane |
| SMILES | COCC([Si](C)(C)C)[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C22H34OSi2/c1-22(2,3)25(19-14-10-8-11-15-19,20-16-12-9-13-17-20)21(18-23-4)24(5,6)7/h8-17,21H,18H2,1-7H3 |
| InChIKey | YJWINCLEXKOOLH-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.69 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|