C20H25F3O4SSi — CID 174145918
[3-[tert-butyl(diphenyl)silyl]-3-hydroxypropyl] trifluoromethanesulfonate (PubChem CID 174145918) has the molecular formula C20H25F3O4SSi and a molecular weight of 446.56 g/mol. Its IUPAC name is [3-[tert-butyl(diphenyl)silyl]-3-hydroxypropyl] trifluoromethanesulfonate.
| Compound Name | [3-[tert-butyl(diphenyl)silyl]-3-hydroxypropyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 174145918 |
| Molecular Formula | C20H25F3O4SSi |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | [3-[tert-butyl(diphenyl)silyl]-3-hydroxypropyl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)[Si](c1ccccc1)(c1ccccc1)C(O)CCOS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C20H25F3O4SSi/c1-19(2,3)29(16-10-6-4-7-11-16,17-12-8-5-9-13-17)18(24)14-15-27-28(25,26)20(21,22)23/h4-13,18,24H,14-15H2,1-3H3 |
| InChIKey | WSMTZALQOGNCEZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|