C26H38O4Si — CID 69304890
8-[tert-butyl(diphenyl)silyl]-4,6,8-trihydroxy-2,2-dimethyloctan-3-one (PubChem CID 69304890) has the molecular formula C26H38O4Si and a molecular weight of 442.67 g/mol. Its IUPAC name is 8-[tert-butyl(diphenyl)silyl]-4,6,8-trihydroxy-2,2-dimethyloctan-3-one.
| Compound Name | 8-[tert-butyl(diphenyl)silyl]-4,6,8-trihydroxy-2,2-dimethyloctan-3-one |
|---|---|
| PubChem CID | 69304890 |
| Molecular Formula | C26H38O4Si |
| Molecular Weight | 442.67 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | 8-[tert-butyl(diphenyl)silyl]-4,6,8-trihydroxy-2,2-dimethyloctan-3-one |
| SMILES | CC(C)(C)C(=O)C(O)CC(O)CC(O)[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H38O4Si/c1-25(2,3)24(30)22(28)17-19(27)18-23(29)31(26(4,5)6,20-13-9-7-10-14-20)21-15-11-8-12-16-21/h7-16,19,22-23,27-29H,17-18H2,1-6H3 |
| InChIKey | QRTPRAHKEGUWQV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.67 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|