C19H28O3 — CID 155691972
(E,4S)-4-hydroxy-2,2,8-trimethyl-8-phenylmethoxynon-6-en-3-one (PubChem CID 155691972) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is (E,4S)-4-hydroxy-2,2,8-trimethyl-8-phenylmethoxynon-6-en-3-one.
| Compound Name | (E,4S)-4-hydroxy-2,2,8-trimethyl-8-phenylmethoxynon-6-en-3-one |
|---|---|
| PubChem CID | 155691972 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (E,4S)-4-hydroxy-2,2,8-trimethyl-8-phenylmethoxynon-6-en-3-one |
| SMILES | CC(C)(/C=C/C[C@H](O)C(=O)C(C)(C)C)OCc1ccccc1 |
| InChI | InChI=1S/C19H28O3/c1-18(2,3)17(21)16(20)12-9-13-19(4,5)22-14-15-10-7-6-8-11-15/h6-11,13,16,20H,12,14H2,1-5H3/b13-9+/t16-/m0/s1 |
| InChIKey | UVLMGBJBBYBEPS-WQMJKPAKSA-N |
| XLogP | 3.90 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|