C15H27NOSi — CID 100990438
(2R)-1-(tert-butyl-methyl-phenylsilyl)oxybutan-2-amine (PubChem CID 100990438) has the molecular formula C15H27NOSi and a molecular weight of 265.47 g/mol. Its IUPAC name is (2R)-1-(tert-butyl-methyl-phenylsilyl)oxybutan-2-amine.
| Compound Name | (2R)-1-(tert-butyl-methyl-phenylsilyl)oxybutan-2-amine |
|---|---|
| PubChem CID | 100990438 |
| Molecular Formula | C15H27NOSi |
| Molecular Weight | 265.47 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | (2R)-1-(tert-butyl-methyl-phenylsilyl)oxybutan-2-amine |
| SMILES | CC[C@@H](N)CO[Si@](C)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C15H27NOSi/c1-6-13(16)12-17-18(5,15(2,3)4)14-10-8-7-9-11-14/h7-11,13H,6,12,16H2,1-5H3/t13-,18-/m1/s1 |
| InChIKey | ZGDKMWBWOUBXIO-FZKQIMNGSA-N |
| XLogP | 3.02 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|