C26H40O3 — CID 45257846
(2S,4R,5R)-4-[(1E,5E)-6-methylpentadeca-1,5-dienyl]-2-phenyl-1,3-dioxan-5-ol (PubChem CID 45257846) has the molecular formula C26H40O3 and a molecular weight of 400.60 g/mol. Its IUPAC name is (2S,4R,5R)-4-[(1E,5E)-6-methylpentadeca-1,5-dienyl]-2-phenyl-1,3-dioxan-5-ol.
| Compound Name | (2S,4R,5R)-4-[(1E,5E)-6-methylpentadeca-1,5-dienyl]-2-phenyl-1,3-dioxan-5-ol |
|---|---|
| PubChem CID | 45257846 |
| Molecular Formula | C26H40O3 |
| Molecular Weight | 400.60 g/mol |
| Exact Mass | 400.30 |
| IUPAC Name | (2S,4R,5R)-4-[(1E,5E)-6-methylpentadeca-1,5-dienyl]-2-phenyl-1,3-dioxan-5-ol |
| SMILES | CCCCCCCCC/C(C)=C/CC/C=C/[C@H]1O[C@@H](c2ccccc2)OC[C@H]1O |
| InChI | InChI=1S/C26H40O3/c1-3-4-5-6-7-8-11-16-22(2)17-12-9-15-20-25-24(27)21-28-26(29-25)23-18-13-10-14-19-23/h10,13-15,17-20,24-27H,3-9,11-12,16,21H2,1-2H3/b20-15+,22-17+/t24-,25-,26+/m1/s1 |
| InChIKey | XSMCBHFKHCIEIX-VORQFKDFSA-N |
| XLogP | 6.88 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.60 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|