C22H41NO2 — CID 11110925
(4R,5S)-2,2-dimethyl-4-[(1E,5E)-6-methylpentadeca-1,5-dienyl]-1,3-dioxan-5-amine (PubChem CID 11110925) has the molecular formula C22H41NO2 and a molecular weight of 351.58 g/mol. Its IUPAC name is (4R,5S)-2,2-dimethyl-4-[(1E,5E)-6-methylpentadeca-1,5-dienyl]-1,3-dioxan-5-amine.
| Compound Name | (4R,5S)-2,2-dimethyl-4-[(1E,5E)-6-methylpentadeca-1,5-dienyl]-1,3-dioxan-5-amine |
|---|---|
| PubChem CID | 11110925 |
| Molecular Formula | C22H41NO2 |
| Molecular Weight | 351.58 g/mol |
| Exact Mass | 351.31 |
| IUPAC Name | (4R,5S)-2,2-dimethyl-4-[(1E,5E)-6-methylpentadeca-1,5-dienyl]-1,3-dioxan-5-amine |
| SMILES | CCCCCCCCC/C(C)=C/CC/C=C/[C@H]1OC(C)(C)OC[C@@H]1N |
| InChI | InChI=1S/C22H41NO2/c1-5-6-7-8-9-10-12-15-19(2)16-13-11-14-17-21-20(23)18-24-22(3,4)25-21/h14,16-17,20-21H,5-13,15,18,23H2,1-4H3/b17-14+,19-16+/t20-,21+/m0/s1 |
| InChIKey | LEXOEYANANDHCC-UNVDSQSESA-N |
| XLogP | 5.89 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.58 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|