C19H37N — CID 87493496
9-methyloctadeca-4,8-dien-2-amine (PubChem CID 87493496) has the molecular formula C19H37N and a molecular weight of 279.51 g/mol. Its IUPAC name is 9-methyloctadeca-4,8-dien-2-amine.
| Compound Name | 9-methyloctadeca-4,8-dien-2-amine |
|---|---|
| PubChem CID | 87493496 |
| Molecular Formula | C19H37N |
| Molecular Weight | 279.51 g/mol |
| Exact Mass | 279.29 |
| IUPAC Name | 9-methyloctadeca-4,8-dien-2-amine |
| SMILES | CCCCCCCCCC(C)=CCCC=CCC(C)N |
| InChI | InChI=1S/C19H37N/c1-4-5-6-7-8-9-12-15-18(2)16-13-10-11-14-17-19(3)20/h11,14,16,19H,4-10,12-13,15,17,20H2,1-3H3 |
| InChIKey | LUZOFBMJHCKURR-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.51 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|