C28H50O6Si2 — CID 11489560
[(2R,4S,5R)-5-[(2S,3R)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]pent-4-en-2-yl]oxy-2-phenyl-1,3-dioxan-4-yl]methanol (PubChem CID 11489560) has the molecular formula C28H50O6Si2 and a molecular weight of 538.87 g/mol. Its IUPAC name is [(2R,4S,5R)-5-[(2S,3R)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]pent-4-en-2-yl]oxy-2-phenyl-1,3-dioxan-4-yl]methanol.
| Compound Name | [(2R,4S,5R)-5-[(2S,3R)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]pent-4-en-2-yl]oxy-2-phenyl-1,3-dioxan-4-yl]methanol |
|---|---|
| PubChem CID | 11489560 |
| Molecular Formula | C28H50O6Si2 |
| Molecular Weight | 538.87 g/mol |
| Exact Mass | 538.31 |
| IUPAC Name | [(2R,4S,5R)-5-[(2S,3R)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]pent-4-en-2-yl]oxy-2-phenyl-1,3-dioxan-4-yl]methanol |
| SMILES | C=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](CO[Si](C)(C)C(C)(C)C)O[C@@H]1CO[C@@H](c2ccccc2)O[C@H]1CO |
| InChI | InChI=1S/C28H50O6Si2/c1-12-22(34-36(10,11)28(5,6)7)25(20-31-35(8,9)27(2,3)4)32-24-19-30-26(33-23(24)18-29)21-16-14-13-15-17-21/h12-17,22-26,29H,1,18-20H2,2-11H3/t22-,23+,24-,25+,26-/m1/s1 |
| InChIKey | HOCIOBCSPGFJSG-UVIRKTLASA-N |
| XLogP | 6.44 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.87 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|