C31H33NO5 — CID 11340990
(4S)-4-[[(2S,4R,5R)-2-methyl-4-(trityloxymethyl)-1,3-dioxan-5-yl]oxy]-3-propan-2-ylideneazetidin-2-one (PubChem CID 11340990) has the molecular formula C31H33NO5 and a molecular weight of 499.61 g/mol. Its IUPAC name is (4S)-4-[[(2S,4R,5R)-2-methyl-4-(trityloxymethyl)-1,3-dioxan-5-yl]oxy]-3-propan-2-ylideneazetidin-2-one.
| Compound Name | (4S)-4-[[(2S,4R,5R)-2-methyl-4-(trityloxymethyl)-1,3-dioxan-5-yl]oxy]-3-propan-2-ylideneazetidin-2-one |
|---|---|
| PubChem CID | 11340990 |
| Molecular Formula | C31H33NO5 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.24 |
| IUPAC Name | (4S)-4-[[(2S,4R,5R)-2-methyl-4-(trityloxymethyl)-1,3-dioxan-5-yl]oxy]-3-propan-2-ylideneazetidin-2-one |
| SMILES | CC(C)=C1C(=O)N[C@H]1O[C@@H]1CO[C@H](C)O[C@@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H33NO5/c1-21(2)28-29(33)32-30(28)37-26-19-34-22(3)36-27(26)20-35-31(23-13-7-4-8-14-23,24-15-9-5-10-16-24)25-17-11-6-12-18-25/h4-18,22,26-27,30H,19-20H2,1-3H3,(H,32,33)/t22-,26+,27+,30-/m0/s1 |
| InChIKey | VGBMORDKXFZQBX-JDFWKDIJSA-N |
| XLogP | 4.93 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|