C25H24O4 — CID 102066270
(2R,4S)-2-methyl-4-(trityloxymethyl)-1,3-dioxan-5-one (PubChem CID 102066270) has the molecular formula C25H24O4 and a molecular weight of 388.46 g/mol. Its IUPAC name is (2R,4S)-2-methyl-4-(trityloxymethyl)-1,3-dioxan-5-one.
| Compound Name | (2R,4S)-2-methyl-4-(trityloxymethyl)-1,3-dioxan-5-one |
|---|---|
| PubChem CID | 102066270 |
| Molecular Formula | C25H24O4 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | (2R,4S)-2-methyl-4-(trityloxymethyl)-1,3-dioxan-5-one |
| SMILES | C[C@@H]1OCC(=O)[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C25H24O4/c1-19-27-17-23(26)24(29-19)18-28-25(20-11-5-2-6-12-20,21-13-7-3-8-14-21)22-15-9-4-10-16-22/h2-16,19,24H,17-18H2,1H3/t19-,24+/m1/s1 |
| InChIKey | UNMXKESPBOQZAD-DVECYGJZSA-N |
| XLogP | 4.33 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|