C15H20O3S2 — CID 42599169
(4S,5R)-4-(1,3-dithian-2-ylmethyl)-2-phenyl-1,3-dioxan-5-ol (PubChem CID 42599169) has the molecular formula C15H20O3S2 and a molecular weight of 312.46 g/mol. Its IUPAC name is (4S,5R)-4-(1,3-dithian-2-ylmethyl)-2-phenyl-1,3-dioxan-5-ol.
| Compound Name | (4S,5R)-4-(1,3-dithian-2-ylmethyl)-2-phenyl-1,3-dioxan-5-ol |
|---|---|
| PubChem CID | 42599169 |
| Molecular Formula | C15H20O3S2 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | (4S,5R)-4-(1,3-dithian-2-ylmethyl)-2-phenyl-1,3-dioxan-5-ol |
| SMILES | O[C@@H]1COC(c2ccccc2)O[C@H]1CC1SCCCS1 |
| InChI | InChI=1S/C15H20O3S2/c16-12-10-17-15(11-5-2-1-3-6-11)18-13(12)9-14-19-7-4-8-20-14/h1-3,5-6,12-16H,4,7-10H2/t12-,13+,15?/m1/s1 |
| InChIKey | YJNXGXXLJTVDSK-NEJHNUGDSA-N |
| XLogP | 3.05 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |