C14H20O — CID 57244338
(2S,3S)-3-methyl-2-(4-phenylbutyl)oxetane (PubChem CID 57244338) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is (2S,3S)-3-methyl-2-(4-phenylbutyl)oxetane.
| Compound Name | (2S,3S)-3-methyl-2-(4-phenylbutyl)oxetane |
|---|---|
| PubChem CID | 57244338 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | (2S,3S)-3-methyl-2-(4-phenylbutyl)oxetane |
| SMILES | C[C@H]1CO[C@H]1CCCCc1ccccc1 |
| InChI | InChI=1S/C14H20O/c1-12-11-15-14(12)10-6-5-9-13-7-3-2-4-8-13/h2-4,7-8,12,14H,5-6,9-11H2,1H3/t12-,14-/m0/s1 |
| InChIKey | LGNCICATQRKUNN-JSGCOSHPSA-N |
| XLogP | 3.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|