C11H15N3 — CID 79510463
5-(2-phenylethyl)-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 79510463) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is 5-(2-phenylethyl)-4,5-dihydro-1H-imidazol-2-amine.
| Compound Name | 5-(2-phenylethyl)-4,5-dihydro-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 79510463 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 5-(2-phenylethyl)-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | NC1=NCC(CCc2ccccc2)N1 |
| InChI | InChI=1S/C11H15N3/c12-11-13-8-10(14-11)7-6-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H3,12,13,14) |
| InChIKey | LYQPEJYLOVAGGY-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |