C7H11N3 — CID 89143527
5-but-3-ynyl-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 89143527) has the molecular formula C7H11N3 and a molecular weight of 137.19 g/mol. Its IUPAC name is 5-but-3-ynyl-4,5-dihydro-1H-imidazol-2-amine.
| Compound Name | 5-but-3-ynyl-4,5-dihydro-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 89143527 |
| Molecular Formula | C7H11N3 |
| Molecular Weight | 137.19 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | 5-but-3-ynyl-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | C#CCCC1CN=C(N)N1 |
| InChI | InChI=1S/C7H11N3/c1-2-3-4-6-5-9-7(8)10-6/h1,6H,3-5H2,(H3,8,9,10) |
| InChIKey | STAGWNRTYWYDRL-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.19 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|