C10H16N2 — CID 10535027
(1R,4S)-7-pent-4-ynyl-2,3-diazabicyclo[2.2.1]heptane (PubChem CID 10535027) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is (1R,4S)-7-pent-4-ynyl-2,3-diazabicyclo[2.2.1]heptane.
| Compound Name | (1R,4S)-7-pent-4-ynyl-2,3-diazabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 10535027 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | (1R,4S)-7-pent-4-ynyl-2,3-diazabicyclo[2.2.1]heptane |
| SMILES | C#CCCCC1[C@@H]2CC[C@H]1NN2 |
| InChI | InChI=1S/C10H16N2/c1-2-3-4-5-8-9-6-7-10(8)12-11-9/h1,8-12H,3-7H2/t8?,9-,10+ |
| InChIKey | ZLEQJHKOUJUDDZ-PBINXNQUSA-N |
| XLogP | 1.04 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|