About 2-benzylpiperidin-3-ol;hydrochloride
2-benzylpiperidin-3-ol;hydrochloride (PubChem CID 115036439) has the molecular formula C12H18ClNO
and a molecular weight of 227.73 g/mol. Its IUPAC name is 2-benzylpiperidin-3-ol;hydrochloride.
Molecular Properties
| Compound Name | 2-benzylpiperidin-3-ol;hydrochloride |
| PubChem CID | 115036439 |
| Molecular Formula | C12H18ClNO |
| Molecular Weight | 227.73 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 2-benzylpiperidin-3-ol;hydrochloride |
| SMILES | Cl.OC1CCCNC1Cc1ccccc1 |
| InChI | InChI=1S/C12H17NO.ClH/c14-12-7-4-8-13-11(12)9-10-5-2-1-3-6-10;/h1-3,5-6,11-14H,4,7-9H2;1H |
| InChIKey | WKQZLZLSCYZTCQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.73 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzylpiperidin-3-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylpiperidin-3-ol;hydrochloride?
The IUPAC name of 2-benzylpiperidin-3-ol;hydrochloride (CID 115036439) is 2-benzylpiperidin-3-ol;hydrochloride.
What is the SMILES notation for 2-benzylpiperidin-3-ol;hydrochloride?
The canonical SMILES for 2-benzylpiperidin-3-ol;hydrochloride is Cl.OC1CCCNC1Cc1ccccc1.
What is the InChIKey of 2-benzylpiperidin-3-ol;hydrochloride?
The InChIKey is WKQZLZLSCYZTCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO.ClH/c14-12-7-4-8-13-11(12)9-10-5-2-1-3-6-10;/h1-3,5-6,11-14H,4,7-9H2;1H.
What are the key properties of 2-benzylpiperidin-3-ol;hydrochloride?
2-benzylpiperidin-3-ol;hydrochloride has a molecular weight of 227.73 g/mol, XLogP of 1.76, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylpiperidin-3-ol;hydrochloride is sourced from PubChem (CID 115036439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).