C11H14BrNO — CID 131001241
[(2S,3S)-3-(2-bromophenyl)pyrrolidin-2-yl]methanol (PubChem CID 131001241) has the molecular formula C11H14BrNO and a molecular weight of 256.14 g/mol. Its IUPAC name is [(2S,3S)-3-(2-bromophenyl)pyrrolidin-2-yl]methanol.
| Compound Name | [(2S,3S)-3-(2-bromophenyl)pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 131001241 |
| Molecular Formula | C11H14BrNO |
| Molecular Weight | 256.14 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | [(2S,3S)-3-(2-bromophenyl)pyrrolidin-2-yl]methanol |
| SMILES | OC[C@H]1NCC[C@H]1c1ccccc1Br |
| InChI | InChI=1S/C11H14BrNO/c12-10-4-2-1-3-8(10)9-5-6-13-11(9)7-14/h1-4,9,11,13-14H,5-7H2/t9-,11+/m0/s1 |
| InChIKey | FDOPQKYELNCIIJ-GXSJLCMTSA-N |
| XLogP | 1.89 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.14 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |