C10H12BrNO — CID 96994557
[(1R)-5-bromo-1,2,3,4-tetrahydroisoquinolin-1-yl]methanol (PubChem CID 96994557) has the molecular formula C10H12BrNO and a molecular weight of 242.12 g/mol. Its IUPAC name is [(1R)-5-bromo-1,2,3,4-tetrahydroisoquinolin-1-yl]methanol.
| Compound Name | [(1R)-5-bromo-1,2,3,4-tetrahydroisoquinolin-1-yl]methanol |
|---|---|
| PubChem CID | 96994557 |
| Molecular Formula | C10H12BrNO |
| Molecular Weight | 242.12 g/mol |
| Exact Mass | 241.01 |
| IUPAC Name | [(1R)-5-bromo-1,2,3,4-tetrahydroisoquinolin-1-yl]methanol |
| SMILES | OC[C@@H]1NCCc2c(Br)cccc21 |
| InChI | InChI=1S/C10H12BrNO/c11-9-3-1-2-8-7(9)4-5-12-10(8)6-13/h1-3,10,12-13H,4-6H2/t10-/m0/s1 |
| InChIKey | CIEONVMAFJNKPK-JTQLQIEISA-N |
| XLogP | 1.63 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.12 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |