C9H12N2O — CID 130900884
[(1S)-4-amino-2,3-dihydro-1H-isoindol-1-yl]methanol (PubChem CID 130900884) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is [(1S)-4-amino-2,3-dihydro-1H-isoindol-1-yl]methanol.
| Compound Name | [(1S)-4-amino-2,3-dihydro-1H-isoindol-1-yl]methanol |
|---|---|
| PubChem CID | 130900884 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | [(1S)-4-amino-2,3-dihydro-1H-isoindol-1-yl]methanol |
| SMILES | Nc1cccc2c1CN[C@@H]2CO |
| InChI | InChI=1S/C9H12N2O/c10-8-3-1-2-6-7(8)4-11-9(6)5-12/h1-3,9,11-12H,4-5,10H2/t9-/m1/s1 |
| InChIKey | JIACIENKESOWDX-SECBINFHSA-N |
| XLogP | 0.41 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|