C12H15IN2O — CID 68879930
N-[1-(iodomethyl)-1,2,3,4-tetrahydroisoquinolin-5-yl]acetamide (PubChem CID 68879930) has the molecular formula C12H15IN2O and a molecular weight of 330.17 g/mol. Its IUPAC name is N-[1-(iodomethyl)-1,2,3,4-tetrahydroisoquinolin-5-yl]acetamide.
| Compound Name | N-[1-(iodomethyl)-1,2,3,4-tetrahydroisoquinolin-5-yl]acetamide |
|---|---|
| PubChem CID | 68879930 |
| Molecular Formula | C12H15IN2O |
| Molecular Weight | 330.17 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | N-[1-(iodomethyl)-1,2,3,4-tetrahydroisoquinolin-5-yl]acetamide |
| SMILES | CC(=O)Nc1cccc2c1CCNC2CI |
| InChI | InChI=1S/C12H15IN2O/c1-8(16)15-11-4-2-3-9-10(11)5-6-14-12(9)7-13/h2-4,12,14H,5-7H2,1H3,(H,15,16) |
| InChIKey | MGOPQUNTFZSCDH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.17 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|