C12H14O — CID 139660761
2,2,3,3-tetradeuterio-4-phenylcyclohexan-1-one (PubChem CID 139660761) has the molecular formula C12H14O and a molecular weight of 178.27 g/mol. Its IUPAC name is 2,2,3,3-tetradeuterio-4-phenylcyclohexan-1-one.
| Compound Name | 2,2,3,3-tetradeuterio-4-phenylcyclohexan-1-one |
|---|---|
| PubChem CID | 139660761 |
| Molecular Formula | C12H14O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.13 |
| IUPAC Name | 2,2,3,3-tetradeuterio-4-phenylcyclohexan-1-one |
| SMILES | [2H]C1([2H])C(=O)CCC(c2ccccc2)C1([2H])[2H] |
| InChI | InChI=1S/C12H14O/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-5,11H,6-9H2/i6D2,8D2 |
| InChIKey | YKAYMASDSHFOGI-GBIJOAKOSA-N |
| XLogP | 2.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |