C11H7F5O3 — CID 146011015
methyl 3-(2,2,3,3,3-pentafluoropropanoyl)benzoate (PubChem CID 146011015) has the molecular formula C11H7F5O3 and a molecular weight of 282.16 g/mol. Its IUPAC name is methyl 3-(2,2,3,3,3-pentafluoropropanoyl)benzoate.
| Compound Name | methyl 3-(2,2,3,3,3-pentafluoropropanoyl)benzoate |
|---|---|
| PubChem CID | 146011015 |
| Molecular Formula | C11H7F5O3 |
| Molecular Weight | 282.16 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | methyl 3-(2,2,3,3,3-pentafluoropropanoyl)benzoate |
| SMILES | COC(=O)c1cccc(C(=O)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C11H7F5O3/c1-19-9(18)7-4-2-3-6(5-7)8(17)10(12,13)11(14,15)16/h2-5H,1H3 |
| InChIKey | VYQAVZRGGHOBCW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.16 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|