C15H10F13IO — CID 156764159
1-iodo-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-methoxyoctyl)benzene (PubChem CID 156764159) has the molecular formula C15H10F13IO and a molecular weight of 580.12 g/mol. Its IUPAC name is 1-iodo-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-methoxyoctyl)benzene.
| Compound Name | 1-iodo-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-methoxyoctyl)benzene |
|---|---|
| PubChem CID | 156764159 |
| Molecular Formula | C15H10F13IO |
| Molecular Weight | 580.12 g/mol |
| Exact Mass | 579.96 |
| IUPAC Name | 1-iodo-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-methoxyoctyl)benzene |
| SMILES | COC(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1ccccc1I |
| InChI | InChI=1S/C15H10F13IO/c1-30-9(7-4-2-3-5-8(7)29)6-10(16,17)11(18,19)12(20,21)13(22,23)14(24,25)15(26,27)28/h2-5,9H,6H2,1H3 |
| InChIKey | IEGOVZWPJAEPRO-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.12 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|