C12H10F7IO — CID 156763741
1-(3,3,4,4,5,5,5-heptafluoro-1-methoxypentyl)-2-iodobenzene (PubChem CID 156763741) has the molecular formula C12H10F7IO and a molecular weight of 430.10 g/mol. Its IUPAC name is 1-(3,3,4,4,5,5,5-heptafluoro-1-methoxypentyl)-2-iodobenzene.
| Compound Name | 1-(3,3,4,4,5,5,5-heptafluoro-1-methoxypentyl)-2-iodobenzene |
|---|---|
| PubChem CID | 156763741 |
| Molecular Formula | C12H10F7IO |
| Molecular Weight | 430.10 g/mol |
| Exact Mass | 429.97 |
| IUPAC Name | 1-(3,3,4,4,5,5,5-heptafluoro-1-methoxypentyl)-2-iodobenzene |
| SMILES | COC(CC(F)(F)C(F)(F)C(F)(F)F)c1ccccc1I |
| InChI | InChI=1S/C12H10F7IO/c1-21-9(7-4-2-3-5-8(7)20)6-10(13,14)11(15,16)12(17,18)19/h2-5,9H,6H2,1H3 |
| InChIKey | XPMNEMSPPMUTQW-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.10 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|