C28H19F20NO4 — CID 11216602
(2S)-3-(4-fluorophenyl)-2-[[4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-nonadecafluoroundecyl)phenyl]methoxycarbonylamino]propanoic acid (PubChem CID 11216602) has the molecular formula C28H19F20NO4 and a molecular weight of 813.42 g/mol. Its IUPAC name is (2S)-3-(4-fluorophenyl)-2-[[4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-nonadecafluoroundecyl)phenyl]methoxycarbonylamino]propanoic acid.
| Compound Name | (2S)-3-(4-fluorophenyl)-2-[[4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-nonadecafluoroundecyl)phenyl]methoxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 11216602 |
| Molecular Formula | C28H19F20NO4 |
| Molecular Weight | 813.42 g/mol |
| Exact Mass | 813.10 |
| IUPAC Name | (2S)-3-(4-fluorophenyl)-2-[[4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-nonadecafluoroundecyl)phenyl]methoxycarbonylamino]propanoic acid |
| SMILES | O=C(N[C@@H](Cc1ccc(F)cc1)C(=O)O)OCc1ccc(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C28H19F20NO4/c29-16-7-5-14(6-8-16)11-17(18(50)51)49-19(52)53-12-15-3-1-13(2-4-15)9-10-20(30,31)21(32,33)22(34,35)23(36,37)24(38,39)25(40,41)26(42,43)27(44,45)28(46,47)48/h1-8,17H,9-12H2,(H,49,52)(H,50,51)/t17-/m0/s1 |
| InChIKey | HFPQMPJUMGUFOS-KRWDZBQOSA-N |
| XLogP | 9.33 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.42 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|