C26H25BrFN3O5 — CID 134540585
2-[[3-(4-aminophenyl)-2-[(4-bromophenyl)methoxycarbonylamino]propanoyl]amino]-3-(4-fluorophenyl)propanoic acid (PubChem CID 134540585) has the molecular formula C26H25BrFN3O5 and a molecular weight of 558.40 g/mol. Its IUPAC name is 2-[[3-(4-aminophenyl)-2-[(4-bromophenyl)methoxycarbonylamino]propanoyl]amino]-3-(4-fluorophenyl)propanoic acid.
| Compound Name | 2-[[3-(4-aminophenyl)-2-[(4-bromophenyl)methoxycarbonylamino]propanoyl]amino]-3-(4-fluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 134540585 |
| Molecular Formula | C26H25BrFN3O5 |
| Molecular Weight | 558.40 g/mol |
| Exact Mass | 557.10 |
| IUPAC Name | 2-[[3-(4-aminophenyl)-2-[(4-bromophenyl)methoxycarbonylamino]propanoyl]amino]-3-(4-fluorophenyl)propanoic acid |
| SMILES | Nc1ccc(CC(NC(=O)OCc2ccc(Br)cc2)C(=O)NC(Cc2ccc(F)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C26H25BrFN3O5/c27-19-7-1-18(2-8-19)15-36-26(35)31-22(13-17-5-11-21(29)12-6-17)24(32)30-23(25(33)34)14-16-3-9-20(28)10-4-16/h1-12,22-23H,13-15,29H2,(H,30,32)(H,31,35)(H,33,34) |
| InChIKey | YVXHEFDEVPNPJY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.40 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|