C25H22F13NO3 — CID 87637584
benzyl N-[(2S,3S)-6,6,7,7,8,8,9,9,10,10,11,11,11-tridecafluoro-3-hydroxy-1-phenylundecan-2-yl]carbamate (PubChem CID 87637584) has the molecular formula C25H22F13NO3 and a molecular weight of 631.43 g/mol. Its IUPAC name is benzyl N-[(2S,3S)-6,6,7,7,8,8,9,9,10,10,11,11,11-tridecafluoro-3-hydroxy-1-phenylundecan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S,3S)-6,6,7,7,8,8,9,9,10,10,11,11,11-tridecafluoro-3-hydroxy-1-phenylundecan-2-yl]carbamate |
|---|---|
| PubChem CID | 87637584 |
| Molecular Formula | C25H22F13NO3 |
| Molecular Weight | 631.43 g/mol |
| Exact Mass | 631.14 |
| IUPAC Name | benzyl N-[(2S,3S)-6,6,7,7,8,8,9,9,10,10,11,11,11-tridecafluoro-3-hydroxy-1-phenylundecan-2-yl]carbamate |
| SMILES | O=C(N[C@@H](Cc1ccccc1)[C@@H](O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OCc1ccccc1 |
| InChI | InChI=1S/C25H22F13NO3/c26-20(27,21(28,29)22(30,31)23(32,33)24(34,35)25(36,37)38)12-11-18(40)17(13-15-7-3-1-4-8-15)39-19(41)42-14-16-9-5-2-6-10-16/h1-10,17-18,40H,11-14H2,(H,39,41)/t17-,18-/m0/s1 |
| InChIKey | DHJQZGJZXGZEMT-ROUUACIJSA-N |
| XLogP | 7.40 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.43 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|