C30H35F13O2 — CID 18650590
[4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)phenyl] 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate (PubChem CID 18650590) has the molecular formula C30H35F13O2 and a molecular weight of 674.58 g/mol. Its IUPAC name is [4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)phenyl] 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate.
| Compound Name | [4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)phenyl] 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 18650590 |
| Molecular Formula | C30H35F13O2 |
| Molecular Weight | 674.58 g/mol |
| Exact Mass | 674.24 |
| IUPAC Name | [4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)phenyl] 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate |
| SMILES | CCCC1CCC(C2CCC(C(=O)Oc3ccc(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc3)CC2)CC1 |
| InChI | InChI=1S/C30H35F13O2/c1-2-3-18-4-8-20(9-5-18)21-10-12-22(13-11-21)24(44)45-23-14-6-19(7-15-23)16-17-25(31,32)26(33,34)27(35,36)28(37,38)29(39,40)30(41,42)43/h6-7,14-15,18,20-22H,2-5,8-13,16-17H2,1H3 |
| InChIKey | CPOZLLKFERGZCZ-UHFFFAOYSA-N |
| XLogP | 10.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.58 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|