C19H18ClN3O5 — CID 24848501
methyl 2-[6-[(Z)-C-(4-chlorophenyl)-N-(methylcarbamoylamino)carbonimidoyl]-1,3-benzodioxol-5-yl]acetate (PubChem CID 24848501) has the molecular formula C19H18ClN3O5 and a molecular weight of 403.82 g/mol. Its IUPAC name is methyl 2-[6-[(Z)-C-(4-chlorophenyl)-N-(methylcarbamoylamino)carbonimidoyl]-1,3-benzodioxol-5-yl]acetate.
| Compound Name | methyl 2-[6-[(Z)-C-(4-chlorophenyl)-N-(methylcarbamoylamino)carbonimidoyl]-1,3-benzodioxol-5-yl]acetate |
|---|---|
| PubChem CID | 24848501 |
| Molecular Formula | C19H18ClN3O5 |
| Molecular Weight | 403.82 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | methyl 2-[6-[(Z)-C-(4-chlorophenyl)-N-(methylcarbamoylamino)carbonimidoyl]-1,3-benzodioxol-5-yl]acetate |
| SMILES | CNC(=O)N/N=C(/c1ccc(Cl)cc1)c1cc2c(cc1CC(=O)OC)OCO2 |
| InChI | InChI=1S/C19H18ClN3O5/c1-21-19(25)23-22-18(11-3-5-13(20)6-4-11)14-9-16-15(27-10-28-16)7-12(14)8-17(24)26-2/h3-7,9H,8,10H2,1-2H3,(H2,21,23,25)/b22-18- |
| InChIKey | GUEULGGWYFCPIA-PYCFMQQDSA-N |
| XLogP | 2.47 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.82 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|