C11H7Cl2F3O2S — CID 122232586
methyl (Z)-3-(2,4-dichlorophenyl)-2-(trifluoromethylsulfanyl)prop-2-enoate (PubChem CID 122232586) has the molecular formula C11H7Cl2F3O2S and a molecular weight of 331.14 g/mol. Its IUPAC name is methyl (Z)-3-(2,4-dichlorophenyl)-2-(trifluoromethylsulfanyl)prop-2-enoate.
| Compound Name | methyl (Z)-3-(2,4-dichlorophenyl)-2-(trifluoromethylsulfanyl)prop-2-enoate |
|---|---|
| PubChem CID | 122232586 |
| Molecular Formula | C11H7Cl2F3O2S |
| Molecular Weight | 331.14 g/mol |
| Exact Mass | 329.95 |
| IUPAC Name | methyl (Z)-3-(2,4-dichlorophenyl)-2-(trifluoromethylsulfanyl)prop-2-enoate |
| SMILES | COC(=O)/C(=C/c1ccc(Cl)cc1Cl)SC(F)(F)F |
| InChI | InChI=1S/C11H7Cl2F3O2S/c1-18-10(17)9(19-11(14,15)16)4-6-2-3-7(12)5-8(6)13/h2-5H,1H3/b9-4- |
| InChIKey | AVKUCIULXKYKIJ-WTKPLQERSA-N |
| XLogP | 4.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.14 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|