C12H15Cl2NO — CID 91236046
1-(2,4-dichlorophenyl)-N-propan-2-yloxyprop-1-en-2-amine (PubChem CID 91236046) has the molecular formula C12H15Cl2NO and a molecular weight of 260.16 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-N-propan-2-yloxyprop-1-en-2-amine.
| Compound Name | 1-(2,4-dichlorophenyl)-N-propan-2-yloxyprop-1-en-2-amine |
|---|---|
| PubChem CID | 91236046 |
| Molecular Formula | C12H15Cl2NO |
| Molecular Weight | 260.16 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-N-propan-2-yloxyprop-1-en-2-amine |
| SMILES | CC(=Cc1ccc(Cl)cc1Cl)NOC(C)C |
| InChI | InChI=1S/C12H15Cl2NO/c1-8(2)16-15-9(3)6-10-4-5-11(13)7-12(10)14/h4-8,15H,1-3H3 |
| InChIKey | DRKLTULFHBGHRN-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.16 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|